About (4Z)-4-hydroxyiminobenzo[a]anthracene-3,7,12-trione
(4Z)-4-hydroxyiminobenzo[a]anthracene-3,7,12-trione (PubChem CID 135588781) has the molecular formula C18H9NO4
and a molecular weight of 303.27 g/mol. Its IUPAC name is (4Z)-4-hydroxyiminobenzo[a]anthracene-3,7,12-trione.
Molecular Properties
| Compound Name | (4Z)-4-hydroxyiminobenzo[a]anthracene-3,7,12-trione |
| PubChem CID | 135588781 |
| Molecular Formula | C18H9NO4 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | (4Z)-4-hydroxyiminobenzo[a]anthracene-3,7,12-trione |
| SMILES | O=c1ccc2c(ccc3c(=O)c4ccccc4c(=O)c32)/c1=N/O |
| InChI | InChI=1S/C18H9NO4/c20-14-8-7-9-10(16(14)19-23)5-6-13-15(9)18(22)12-4-2-1-3-11(12)17(13)21/h1-8,23H/b19-16- |
| InChIKey | ROTKSRZVQDCQEQ-MNDPQUGUSA-N |
| XLogP | 1.39 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-4-hydroxyiminobenzo[a]anthracene-3,7,12-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-hydroxyiminobenzo[a]anthracene-3,7,12-trione?
The IUPAC name of (4Z)-4-hydroxyiminobenzo[a]anthracene-3,7,12-trione (CID 135588781) is (4Z)-4-hydroxyiminobenzo[a]anthracene-3,7,12-trione.
What is the SMILES notation for (4Z)-4-hydroxyiminobenzo[a]anthracene-3,7,12-trione?
The canonical SMILES for (4Z)-4-hydroxyiminobenzo[a]anthracene-3,7,12-trione is O=c1ccc2c(ccc3c(=O)c4ccccc4c(=O)c32)/c1=N/O.
What is the InChIKey of (4Z)-4-hydroxyiminobenzo[a]anthracene-3,7,12-trione?
The InChIKey is ROTKSRZVQDCQEQ-MNDPQUGUSA-N. The full InChI is InChI=1S/C18H9NO4/c20-14-8-7-9-10(16(14)19-23)5-6-13-15(9)18(22)12-4-2-1-3-11(12)17(13)21/h1-8,23H/b19-16-.
What are the key properties of (4Z)-4-hydroxyiminobenzo[a]anthracene-3,7,12-trione?
(4Z)-4-hydroxyiminobenzo[a]anthracene-3,7,12-trione has a molecular weight of 303.27 g/mol, XLogP of 1.39, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-hydroxyiminobenzo[a]anthracene-3,7,12-trione is sourced from PubChem (CID 135588781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).