C17H16N2O3 — CID 135588976
N-[(E)-(4-hydroxyphenyl)methylideneamino]-4-prop-2-enoxybenzamide (PubChem CID 135588976) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is N-[(E)-(4-hydroxyphenyl)methylideneamino]-4-prop-2-enoxybenzamide.
| Compound Name | N-[(E)-(4-hydroxyphenyl)methylideneamino]-4-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 135588976 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | N-[(E)-(4-hydroxyphenyl)methylideneamino]-4-prop-2-enoxybenzamide |
| SMILES | C=CCOc1ccc(C(=O)N/N=C/c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C17H16N2O3/c1-2-11-22-16-9-5-14(6-10-16)17(21)19-18-12-13-3-7-15(20)8-4-13/h2-10,12,20H,1,11H2,(H,19,21)/b18-12+ |
| InChIKey | ZSKVSQUPJDUZHK-LDADJPATSA-N |
| XLogP | 2.72 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|