About 2-(2,4-difluorophenyl)imino-3-ethyl-5-[(Z)-indol-3-ylidenemethyl]-1,3-thiazol-4-ol
2-(2,4-difluorophenyl)imino-3-ethyl-5-[(Z)-indol-3-ylidenemethyl]-1,3-thiazol-4-ol (PubChem CID 135589557) has the molecular formula C20H15F2N3OS
and a molecular weight of 383.42 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)imino-3-ethyl-5-[(Z)-indol-3-ylidenemethyl]-1,3-thiazol-4-ol.
Molecular Properties
| Compound Name | 2-(2,4-difluorophenyl)imino-3-ethyl-5-[(Z)-indol-3-ylidenemethyl]-1,3-thiazol-4-ol |
| PubChem CID | 135589557 |
| Molecular Formula | C20H15F2N3OS |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 2-(2,4-difluorophenyl)imino-3-ethyl-5-[(Z)-indol-3-ylidenemethyl]-1,3-thiazol-4-ol |
| SMILES | CCn1c(O)c(/C=C2\C=Nc3ccccc32)s/c1=N/c1ccc(F)cc1F |
| InChI | InChI=1S/C20H15F2N3OS/c1-2-25-19(26)18(9-12-11-23-16-6-4-3-5-14(12)16)27-20(25)24-17-8-7-13(21)10-15(17)22/h3-11,26H,2H2,1H3/b12-9+,24-20+ |
| InChIKey | XJTYMABSZIUGKG-CGJUGKPTSA-N |
| XLogP | 5.04 |
| TPSA | 49.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2,4-difluorophenyl)imino-3-ethyl-5-[(Z)-indol-3-ylidenemethyl]-1,3-thiazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-difluorophenyl)imino-3-ethyl-5-[(Z)-indol-3-ylidenemethyl]-1,3-thiazol-4-ol?
The IUPAC name of 2-(2,4-difluorophenyl)imino-3-ethyl-5-[(Z)-indol-3-ylidenemethyl]-1,3-thiazol-4-ol (CID 135589557) is 2-(2,4-difluorophenyl)imino-3-ethyl-5-[(Z)-indol-3-ylidenemethyl]-1,3-thiazol-4-ol.
What is the SMILES notation for 2-(2,4-difluorophenyl)imino-3-ethyl-5-[(Z)-indol-3-ylidenemethyl]-1,3-thiazol-4-ol?
The canonical SMILES for 2-(2,4-difluorophenyl)imino-3-ethyl-5-[(Z)-indol-3-ylidenemethyl]-1,3-thiazol-4-ol is CCn1c(O)c(/C=C2\C=Nc3ccccc32)s/c1=N/c1ccc(F)cc1F.
What is the InChIKey of 2-(2,4-difluorophenyl)imino-3-ethyl-5-[(Z)-indol-3-ylidenemethyl]-1,3-thiazol-4-ol?
The InChIKey is XJTYMABSZIUGKG-CGJUGKPTSA-N. The full InChI is InChI=1S/C20H15F2N3OS/c1-2-25-19(26)18(9-12-11-23-16-6-4-3-5-14(12)16)27-20(25)24-17-8-7-13(21)10-15(17)22/h3-11,26H,2H2,1H3/b12-9+,24-20+.
What are the key properties of 2-(2,4-difluorophenyl)imino-3-ethyl-5-[(Z)-indol-3-ylidenemethyl]-1,3-thiazol-4-ol?
2-(2,4-difluorophenyl)imino-3-ethyl-5-[(Z)-indol-3-ylidenemethyl]-1,3-thiazol-4-ol has a molecular weight of 383.42 g/mol, XLogP of 5.04, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-difluorophenyl)imino-3-ethyl-5-[(Z)-indol-3-ylidenemethyl]-1,3-thiazol-4-ol is sourced from PubChem (CID 135589557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).