C22H25N7O3+2 — CID 135589720
N-[(6S,7S)-6,7-dimethyl-5-(1-methylpyridin-1-ium-3-carbonyl)-4-oxo-3,6,7,8-tetrahydropteridin-2-yl]-1-methylpyridin-1-ium-3-carboxamide (PubChem CID 135589720) has the molecular formula C22H25N7O3+2 and a molecular weight of 435.49 g/mol. Its IUPAC name is N-[(6S,7S)-6,7-dimethyl-5-(1-methylpyridin-1-ium-3-carbonyl)-4-oxo-3,6,7,8-tetrahydropteridin-2-yl]-1-methylpyridin-1-ium-3-carboxamide.
| Compound Name | N-[(6S,7S)-6,7-dimethyl-5-(1-methylpyridin-1-ium-3-carbonyl)-4-oxo-3,6,7,8-tetrahydropteridin-2-yl]-1-methylpyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 135589720 |
| Molecular Formula | C22H25N7O3+2 |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | N-[(6S,7S)-6,7-dimethyl-5-(1-methylpyridin-1-ium-3-carbonyl)-4-oxo-3,6,7,8-tetrahydropteridin-2-yl]-1-methylpyridin-1-ium-3-carboxamide |
| SMILES | C[C@@H]1Nc2nc(NC(=O)c3ccc[n+](C)c3)[nH]c(=O)c2N(C(=O)c2ccc[n+](C)c2)[C@H]1C |
| InChI | InChI=1S/C22H23N7O3/c1-13-14(2)29(21(32)16-8-6-10-28(4)12-16)17-18(23-13)24-22(26-20(17)31)25-19(30)15-7-5-9-27(3)11-15/h5-14H,1-4H3,(H-2,23,24,25,26,30,31)/p+2/t13-,14-/m0/s1 |
| InChIKey | DBUKPVKCXJMBPN-KBPBESRZSA-P |
| XLogP | 0.52 |
| TPSA | 114.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|