C52H38N4O8 — CID 135590702
[4-[10,15,20-tris(4-acetyloxyphenyl)-21,23-dihydroporphyrin-5-yl]phenyl] acetate (PubChem CID 135590702) has the molecular formula C52H38N4O8 and a molecular weight of 846.90 g/mol. Its IUPAC name is [4-[10,15,20-tris(4-acetyloxyphenyl)-21,23-dihydroporphyrin-5-yl]phenyl] acetate.
| Compound Name | [4-[10,15,20-tris(4-acetyloxyphenyl)-21,23-dihydroporphyrin-5-yl]phenyl] acetate |
|---|---|
| PubChem CID | 135590702 |
| Molecular Formula | C52H38N4O8 |
| Molecular Weight | 846.90 g/mol |
| Exact Mass | 846.27 |
| IUPAC Name | [4-[10,15,20-tris(4-acetyloxyphenyl)-21,23-dihydroporphyrin-5-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(-c2c3nc(c(-c4ccc(OC(C)=O)cc4)c4ccc([nH]4)c(-c4ccc(OC(C)=O)cc4)c4nc(c(-c5ccc(OC(C)=O)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C52H38N4O8/c1-29(57)61-37-13-5-33(6-14-37)49-41-21-23-43(53-41)50(34-7-15-38(16-8-34)62-30(2)58)45-25-27-47(55-45)52(36-11-19-40(20-12-36)64-32(4)60)48-28-26-46(56-48)51(44-24-22-42(49)54-44)35-9-17-39(18-10-35)63-31(3)59/h5-28,53,56H,1-4H3/b49-41-,49-42-,50-43-,50-45-,51-44-,51-46-,52-47-,52-48- |
| InChIKey | KCDWRULUWBAKKW-RCOMQYLTSA-N |
| XLogP | 11.02 |
| TPSA | 162.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.90 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|