About 4H-pyrido[3,2-a]carbazole-6-carbonitrile
4H-pyrido[3,2-a]carbazole-6-carbonitrile (PubChem CID 135590713) has the molecular formula C16H9N3
and a molecular weight of 243.27 g/mol. Its IUPAC name is 4H-pyrido[3,2-a]carbazole-6-carbonitrile.
Molecular Properties
| Compound Name | 4H-pyrido[3,2-a]carbazole-6-carbonitrile |
| PubChem CID | 135590713 |
| Molecular Formula | C16H9N3 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 4H-pyrido[3,2-a]carbazole-6-carbonitrile |
| SMILES | N#Cc1cc2[nH]cccc2c2nc3ccccc3c12 |
| InChI | InChI=1S/C16H9N3/c17-9-10-8-14-12(5-3-7-18-14)16-15(10)11-4-1-2-6-13(11)19-16/h1-8,18H |
| InChIKey | DEDYJIMLLHVLIV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4H-pyrido[3,2-a]carbazole-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-pyrido[3,2-a]carbazole-6-carbonitrile?
The IUPAC name of 4H-pyrido[3,2-a]carbazole-6-carbonitrile (CID 135590713) is 4H-pyrido[3,2-a]carbazole-6-carbonitrile.
What is the SMILES notation for 4H-pyrido[3,2-a]carbazole-6-carbonitrile?
The canonical SMILES for 4H-pyrido[3,2-a]carbazole-6-carbonitrile is N#Cc1cc2[nH]cccc2c2nc3ccccc3c12.
What is the InChIKey of 4H-pyrido[3,2-a]carbazole-6-carbonitrile?
The InChIKey is DEDYJIMLLHVLIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9N3/c17-9-10-8-14-12(5-3-7-18-14)16-15(10)11-4-1-2-6-13(11)19-16/h1-8,18H.
What are the key properties of 4H-pyrido[3,2-a]carbazole-6-carbonitrile?
4H-pyrido[3,2-a]carbazole-6-carbonitrile has a molecular weight of 243.27 g/mol, XLogP of 3.74, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-pyrido[3,2-a]carbazole-6-carbonitrile is sourced from PubChem (CID 135590713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).