About 1,7-dihydropyrazolo[5,4-d]pyrimidine-4-thione;hydrate
1,7-dihydropyrazolo[5,4-d]pyrimidine-4-thione;hydrate (PubChem CID 135590899) has the molecular formula C5H6N4OS
and a molecular weight of 170.20 g/mol. Its IUPAC name is 1,7-dihydropyrazolo[5,4-d]pyrimidine-4-thione;hydrate.
Molecular Properties
| Compound Name | 1,7-dihydropyrazolo[5,4-d]pyrimidine-4-thione;hydrate |
| PubChem CID | 135590899 |
| Molecular Formula | C5H6N4OS |
| Molecular Weight | 170.20 g/mol |
| Exact Mass | 170.03 |
| IUPAC Name | 1,7-dihydropyrazolo[5,4-d]pyrimidine-4-thione;hydrate |
| SMILES | O.S=c1nc[nH]c2[nH]ncc12 |
| InChI | InChI=1S/C5H4N4S.H2O/c10-5-3-1-8-9-4(3)6-2-7-5;/h1-2H,(H2,6,7,8,9,10);1H2 |
| InChIKey | QONVODDCIVRMSP-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 88.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.20 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,7-dihydropyrazolo[5,4-d]pyrimidine-4-thione;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7-dihydropyrazolo[5,4-d]pyrimidine-4-thione;hydrate?
The IUPAC name of 1,7-dihydropyrazolo[5,4-d]pyrimidine-4-thione;hydrate (CID 135590899) is 1,7-dihydropyrazolo[5,4-d]pyrimidine-4-thione;hydrate.
What is the SMILES notation for 1,7-dihydropyrazolo[5,4-d]pyrimidine-4-thione;hydrate?
The canonical SMILES for 1,7-dihydropyrazolo[5,4-d]pyrimidine-4-thione;hydrate is O.S=c1nc[nH]c2[nH]ncc12.
What is the InChIKey of 1,7-dihydropyrazolo[5,4-d]pyrimidine-4-thione;hydrate?
The InChIKey is QONVODDCIVRMSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4S.H2O/c10-5-3-1-8-9-4(3)6-2-7-5;/h1-2H,(H2,6,7,8,9,10);1H2.
What are the key properties of 1,7-dihydropyrazolo[5,4-d]pyrimidine-4-thione;hydrate?
1,7-dihydropyrazolo[5,4-d]pyrimidine-4-thione;hydrate has a molecular weight of 170.20 g/mol, XLogP of 0.19, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7-dihydropyrazolo[5,4-d]pyrimidine-4-thione;hydrate is sourced from PubChem (CID 135590899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).