About 4-[(E)-2-benzo[e][1,3]benzothiazol-2-ylethenyl]-2,6-dimethylphenol
4-[(E)-2-benzo[e][1,3]benzothiazol-2-ylethenyl]-2,6-dimethylphenol (PubChem CID 135591315) has the molecular formula C21H17NOS
and a molecular weight of 331.44 g/mol. Its IUPAC name is 4-[(E)-2-benzo[e][1,3]benzothiazol-2-ylethenyl]-2,6-dimethylphenol.
Molecular Properties
| Compound Name | 4-[(E)-2-benzo[e][1,3]benzothiazol-2-ylethenyl]-2,6-dimethylphenol |
| PubChem CID | 135591315 |
| Molecular Formula | C21H17NOS |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 4-[(E)-2-benzo[e][1,3]benzothiazol-2-ylethenyl]-2,6-dimethylphenol |
| SMILES | Cc1cc(/C=C/c2nc3c(ccc4ccccc43)s2)cc(C)c1O |
| InChI | InChI=1S/C21H17NOS/c1-13-11-15(12-14(2)21(13)23)7-10-19-22-20-17-6-4-3-5-16(17)8-9-18(20)24-19/h3-12,23H,1-2H3/b10-7+ |
| InChIKey | PBFHVXWYUAYVER-JXMROGBWSA-N |
| XLogP | 5.94 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(E)-2-benzo[e][1,3]benzothiazol-2-ylethenyl]-2,6-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-2-benzo[e][1,3]benzothiazol-2-ylethenyl]-2,6-dimethylphenol?
The IUPAC name of 4-[(E)-2-benzo[e][1,3]benzothiazol-2-ylethenyl]-2,6-dimethylphenol (CID 135591315) is 4-[(E)-2-benzo[e][1,3]benzothiazol-2-ylethenyl]-2,6-dimethylphenol.
What is the SMILES notation for 4-[(E)-2-benzo[e][1,3]benzothiazol-2-ylethenyl]-2,6-dimethylphenol?
The canonical SMILES for 4-[(E)-2-benzo[e][1,3]benzothiazol-2-ylethenyl]-2,6-dimethylphenol is Cc1cc(/C=C/c2nc3c(ccc4ccccc43)s2)cc(C)c1O.
What is the InChIKey of 4-[(E)-2-benzo[e][1,3]benzothiazol-2-ylethenyl]-2,6-dimethylphenol?
The InChIKey is PBFHVXWYUAYVER-JXMROGBWSA-N. The full InChI is InChI=1S/C21H17NOS/c1-13-11-15(12-14(2)21(13)23)7-10-19-22-20-17-6-4-3-5-16(17)8-9-18(20)24-19/h3-12,23H,1-2H3/b10-7+.
What are the key properties of 4-[(E)-2-benzo[e][1,3]benzothiazol-2-ylethenyl]-2,6-dimethylphenol?
4-[(E)-2-benzo[e][1,3]benzothiazol-2-ylethenyl]-2,6-dimethylphenol has a molecular weight of 331.44 g/mol, XLogP of 5.94, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-2-benzo[e][1,3]benzothiazol-2-ylethenyl]-2,6-dimethylphenol is sourced from PubChem (CID 135591315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).