C20H15Cl2N5S — CID 135591401
3-[3-[2-(2,4-dichlorophenyl)imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]indol-1-yl]propanenitrile (PubChem CID 135591401) has the molecular formula C20H15Cl2N5S and a molecular weight of 428.35 g/mol. Its IUPAC name is 3-[3-[2-(2,4-dichlorophenyl)imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]indol-1-yl]propanenitrile.
| Compound Name | 3-[3-[2-(2,4-dichlorophenyl)imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]indol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 135591401 |
| Molecular Formula | C20H15Cl2N5S |
| Molecular Weight | 428.35 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | 3-[3-[2-(2,4-dichlorophenyl)imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]indol-1-yl]propanenitrile |
| SMILES | N#CCCn1cc(C2=NN/C(=N/c3ccc(Cl)cc3Cl)SC2)c2ccccc21 |
| InChI | InChI=1S/C20H15Cl2N5S/c21-13-6-7-17(16(22)10-13)24-20-26-25-18(12-28-20)15-11-27(9-3-8-23)19-5-2-1-4-14(15)19/h1-2,4-7,10-11H,3,9,12H2,(H,24,26) |
| InChIKey | QBGCCKOZTJQMGK-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 65.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.35 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|