C11H9N3O3S — CID 135592221
3-phenacylsulfanyl-1,4-dihydro-1,2,4-triazine-5,6-dione (PubChem CID 135592221) has the molecular formula C11H9N3O3S and a molecular weight of 263.28 g/mol. Its IUPAC name is 3-phenacylsulfanyl-1,4-dihydro-1,2,4-triazine-5,6-dione.
| Compound Name | 3-phenacylsulfanyl-1,4-dihydro-1,2,4-triazine-5,6-dione |
|---|---|
| PubChem CID | 135592221 |
| Molecular Formula | C11H9N3O3S |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 3-phenacylsulfanyl-1,4-dihydro-1,2,4-triazine-5,6-dione |
| SMILES | O=C(CSc1n[nH]c(=O)c(=O)[nH]1)c1ccccc1 |
| InChI | InChI=1S/C11H9N3O3S/c15-8(7-4-2-1-3-5-7)6-18-11-12-9(16)10(17)13-14-11/h1-5H,6H2,(H,13,17)(H,12,14,16) |
| InChIKey | PUQBLCBKHKCRCM-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 95.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|