C14H14Cl2F3N2O4P — CID 135592277
(3E)-5,7-dichloro-3-(1-diethoxyphosphoryl-2,2,2-trifluoroethyl)imino-1H-indol-2-one (PubChem CID 135592277) has the molecular formula C14H14Cl2F3N2O4P and a molecular weight of 433.15 g/mol. Its IUPAC name is (3E)-5,7-dichloro-3-(1-diethoxyphosphoryl-2,2,2-trifluoroethyl)imino-1H-indol-2-one.
| Compound Name | (3E)-5,7-dichloro-3-(1-diethoxyphosphoryl-2,2,2-trifluoroethyl)imino-1H-indol-2-one |
|---|---|
| PubChem CID | 135592277 |
| Molecular Formula | C14H14Cl2F3N2O4P |
| Molecular Weight | 433.15 g/mol |
| Exact Mass | 432.00 |
| IUPAC Name | (3E)-5,7-dichloro-3-(1-diethoxyphosphoryl-2,2,2-trifluoroethyl)imino-1H-indol-2-one |
| SMILES | CCOP(=O)(OCC)C(/N=C1/C(=O)Nc2c(Cl)cc(Cl)cc21)C(F)(F)F |
| InChI | InChI=1S/C14H14Cl2F3N2O4P/c1-3-24-26(23,25-4-2)13(14(17,18)19)21-11-8-5-7(15)6-9(16)10(8)20-12(11)22/h5-6,13H,3-4H2,1-2H3,(H,20,21,22) |
| InChIKey | KFWKBABSJLXOPW-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.15 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|