C16H16ClN3OS — CID 135592530
2-(4-chlorophenyl)-N-[(5Z)-6-imino-2-methyl-5-methylsulfanyliminocyclohexa-1,3-dien-1-yl]acetamide (PubChem CID 135592530) has the molecular formula C16H16ClN3OS and a molecular weight of 333.84 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[(5Z)-6-imino-2-methyl-5-methylsulfanyliminocyclohexa-1,3-dien-1-yl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[(5Z)-6-imino-2-methyl-5-methylsulfanyliminocyclohexa-1,3-dien-1-yl]acetamide |
|---|---|
| PubChem CID | 135592530 |
| Molecular Formula | C16H16ClN3OS |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[(5Z)-6-imino-2-methyl-5-methylsulfanyliminocyclohexa-1,3-dien-1-yl]acetamide |
| SMILES | [H]/N=C1/C(NC(=O)Cc2ccc(Cl)cc2)=C(C)C=C/C1=N/SC |
| InChI | InChI=1S/C16H16ClN3OS/c1-10-3-8-13(20-22-2)15(18)16(10)19-14(21)9-11-4-6-12(17)7-5-11/h3-8,18H,9H2,1-2H3,(H,19,21)/b18-15+,20-13- |
| InChIKey | YCYSGCOVVIFWQI-YGDVMDKKSA-N |
| XLogP | 3.58 |
| TPSA | 65.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|