About (3-ethyl-6-ethylimino-7H-purin-8-yl)-phenylmethanol;5-oxabicyclo[2.1.1]hexane
(3-ethyl-6-ethylimino-7H-purin-8-yl)-phenylmethanol;5-oxabicyclo[2.1.1]hexane (PubChem CID 135592864) has the molecular formula C21H27N5O2
and a molecular weight of 381.48 g/mol. Its IUPAC name is (3-ethyl-6-ethylimino-7H-purin-8-yl)-phenylmethanol;5-oxabicyclo[2.1.1]hexane.
Molecular Properties
| Compound Name | (3-ethyl-6-ethylimino-7H-purin-8-yl)-phenylmethanol;5-oxabicyclo[2.1.1]hexane |
| PubChem CID | 135592864 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | (3-ethyl-6-ethylimino-7H-purin-8-yl)-phenylmethanol;5-oxabicyclo[2.1.1]hexane |
| SMILES | C1CC2CC1O2.CC/N=c1\ncn(CC)c2nc(C(O)c3ccccc3)[nH]c12 |
| InChI | InChI=1S/C16H19N5O.C5H8O/c1-3-17-14-12-16(21(4-2)10-18-14)20-15(19-12)13(22)11-8-6-5-7-9-11;1-2-5-3-4(1)6-5/h5-10,13,22H,3-4H2,1-2H3,(H,19,20);4-5H,1-3H2/b17-14-; |
| InChIKey | CRBQFMLTZUZERK-SBBUSYCLSA-N |
| XLogP | 2.72 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3-ethyl-6-ethylimino-7H-purin-8-yl)-phenylmethanol;5-oxabicyclo[2.1.1]hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethyl-6-ethylimino-7H-purin-8-yl)-phenylmethanol;5-oxabicyclo[2.1.1]hexane?
The IUPAC name of (3-ethyl-6-ethylimino-7H-purin-8-yl)-phenylmethanol;5-oxabicyclo[2.1.1]hexane (CID 135592864) is (3-ethyl-6-ethylimino-7H-purin-8-yl)-phenylmethanol;5-oxabicyclo[2.1.1]hexane.
What is the SMILES notation for (3-ethyl-6-ethylimino-7H-purin-8-yl)-phenylmethanol;5-oxabicyclo[2.1.1]hexane?
The canonical SMILES for (3-ethyl-6-ethylimino-7H-purin-8-yl)-phenylmethanol;5-oxabicyclo[2.1.1]hexane is C1CC2CC1O2.CC/N=c1\ncn(CC)c2nc(C(O)c3ccccc3)[nH]c12.
What is the InChIKey of (3-ethyl-6-ethylimino-7H-purin-8-yl)-phenylmethanol;5-oxabicyclo[2.1.1]hexane?
The InChIKey is CRBQFMLTZUZERK-SBBUSYCLSA-N. The full InChI is InChI=1S/C16H19N5O.C5H8O/c1-3-17-14-12-16(21(4-2)10-18-14)20-15(19-12)13(22)11-8-6-5-7-9-11;1-2-5-3-4(1)6-5/h5-10,13,22H,3-4H2,1-2H3,(H,19,20);4-5H,1-3H2/b17-14-;.
What are the key properties of (3-ethyl-6-ethylimino-7H-purin-8-yl)-phenylmethanol;5-oxabicyclo[2.1.1]hexane?
(3-ethyl-6-ethylimino-7H-purin-8-yl)-phenylmethanol;5-oxabicyclo[2.1.1]hexane has a molecular weight of 381.48 g/mol, XLogP of 2.72, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethyl-6-ethylimino-7H-purin-8-yl)-phenylmethanol;5-oxabicyclo[2.1.1]hexane is sourced from PubChem (CID 135592864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).