C10H10FN3S — CID 135593834
5-(4-fluorophenyl)-N-methyl-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 135593834) has the molecular formula C10H10FN3S and a molecular weight of 223.28 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-methyl-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | 5-(4-fluorophenyl)-N-methyl-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 135593834 |
| Molecular Formula | C10H10FN3S |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 5-(4-fluorophenyl)-N-methyl-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | C/N=C1/NN=C(c2ccc(F)cc2)CS1 |
| InChI | InChI=1S/C10H10FN3S/c1-12-10-14-13-9(6-15-10)7-2-4-8(11)5-3-7/h2-5H,6H2,1H3,(H,12,14) |
| InChIKey | BGHDMGYBBOCDIQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|