C16H23ClN2O — CID 135595231
4-chloro-2-[(2,2,6,6-tetramethylpiperidin-4-yl)iminomethyl]phenol (PubChem CID 135595231) has the molecular formula C16H23ClN2O and a molecular weight of 294.83 g/mol. Its IUPAC name is 4-chloro-2-[(2,2,6,6-tetramethylpiperidin-4-yl)iminomethyl]phenol.
| Compound Name | 4-chloro-2-[(2,2,6,6-tetramethylpiperidin-4-yl)iminomethyl]phenol |
|---|---|
| PubChem CID | 135595231 |
| Molecular Formula | C16H23ClN2O |
| Molecular Weight | 294.83 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 4-chloro-2-[(2,2,6,6-tetramethylpiperidin-4-yl)iminomethyl]phenol |
| SMILES | CC1(C)CC(/N=C/c2cc(Cl)ccc2O)CC(C)(C)N1 |
| InChI | InChI=1S/C16H23ClN2O/c1-15(2)8-13(9-16(3,4)19-15)18-10-11-7-12(17)5-6-14(11)20/h5-7,10,13,19-20H,8-9H2,1-4H3/b18-10+ |
| InChIKey | RIQOYWHZYKGCLN-VCHYOVAHSA-N |
| XLogP | 3.77 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.83 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|