About 2-(chrysen-5-ylmethylamino)-1,7-dihydropurin-6-one
2-(chrysen-5-ylmethylamino)-1,7-dihydropurin-6-one (PubChem CID 135596615) has the molecular formula C24H17N5O
and a molecular weight of 391.43 g/mol. Its IUPAC name is 2-(chrysen-5-ylmethylamino)-1,7-dihydropurin-6-one.
Molecular Properties
| Compound Name | 2-(chrysen-5-ylmethylamino)-1,7-dihydropurin-6-one |
| PubChem CID | 135596615 |
| Molecular Formula | C24H17N5O |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 2-(chrysen-5-ylmethylamino)-1,7-dihydropurin-6-one |
| SMILES | O=c1[nH]c(NCc2cc3ccccc3c3ccc4ccccc4c23)nc2nc[nH]c12 |
| InChI | InChI=1S/C24H17N5O/c30-23-21-22(27-13-26-21)28-24(29-23)25-12-16-11-15-6-2-3-7-17(15)19-10-9-14-5-1-4-8-18(14)20(16)19/h1-11,13H,12H2,(H3,25,26,27,28,29,30) |
| InChIKey | XINSXRDSIDZSGC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(chrysen-5-ylmethylamino)-1,7-dihydropurin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chrysen-5-ylmethylamino)-1,7-dihydropurin-6-one?
The IUPAC name of 2-(chrysen-5-ylmethylamino)-1,7-dihydropurin-6-one (CID 135596615) is 2-(chrysen-5-ylmethylamino)-1,7-dihydropurin-6-one.
What is the SMILES notation for 2-(chrysen-5-ylmethylamino)-1,7-dihydropurin-6-one?
The canonical SMILES for 2-(chrysen-5-ylmethylamino)-1,7-dihydropurin-6-one is O=c1[nH]c(NCc2cc3ccccc3c3ccc4ccccc4c23)nc2nc[nH]c12.
What is the InChIKey of 2-(chrysen-5-ylmethylamino)-1,7-dihydropurin-6-one?
The InChIKey is XINSXRDSIDZSGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17N5O/c30-23-21-22(27-13-26-21)28-24(29-23)25-12-16-11-15-6-2-3-7-17(15)19-10-9-14-5-1-4-8-18(14)20(16)19/h1-11,13H,12H2,(H3,25,26,27,28,29,30).
What are the key properties of 2-(chrysen-5-ylmethylamino)-1,7-dihydropurin-6-one?
2-(chrysen-5-ylmethylamino)-1,7-dihydropurin-6-one has a molecular weight of 391.43 g/mol, XLogP of 4.72, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chrysen-5-ylmethylamino)-1,7-dihydropurin-6-one is sourced from PubChem (CID 135596615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).