C12H9N7 — CID 135597547
8-phenyl-1H-[1,2,4]triazolo[5,1-f]purin-5-amine (PubChem CID 135597547) has the molecular formula C12H9N7 and a molecular weight of 251.25 g/mol. Its IUPAC name is 8-phenyl-1H-[1,2,4]triazolo[5,1-f]purin-5-amine.
| Compound Name | 8-phenyl-1H-[1,2,4]triazolo[5,1-f]purin-5-amine |
|---|---|
| PubChem CID | 135597547 |
| Molecular Formula | C12H9N7 |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 8-phenyl-1H-[1,2,4]triazolo[5,1-f]purin-5-amine |
| SMILES | Nc1nc2nc[nH]c2c2nc(-c3ccccc3)nn12 |
| InChI | InChI=1S/C12H9N7/c13-12-17-10-8(14-6-15-10)11-16-9(18-19(11)12)7-4-2-1-3-5-7/h1-6H,(H2,13,17)(H,14,15) |
| InChIKey | RDEKURLJQZDILX-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 97.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |