C23H29N7O5S — CID 135597637
3-(3-cyclopentyl-8-oxo-7H-[1,2,4]triazolo[3,4-f][1,2,4]triazin-6-yl)-4-ethoxy-N-(2-oxoazepan-3-yl)benzenesulfonamide (PubChem CID 135597637) has the molecular formula C23H29N7O5S and a molecular weight of 515.60 g/mol. Its IUPAC name is 3-(3-cyclopentyl-8-oxo-7H-[1,2,4]triazolo[3,4-f][1,2,4]triazin-6-yl)-4-ethoxy-N-(2-oxoazepan-3-yl)benzenesulfonamide.
| Compound Name | 3-(3-cyclopentyl-8-oxo-7H-[1,2,4]triazolo[3,4-f][1,2,4]triazin-6-yl)-4-ethoxy-N-(2-oxoazepan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 135597637 |
| Molecular Formula | C23H29N7O5S |
| Molecular Weight | 515.60 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | 3-(3-cyclopentyl-8-oxo-7H-[1,2,4]triazolo[3,4-f][1,2,4]triazin-6-yl)-4-ethoxy-N-(2-oxoazepan-3-yl)benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NC2CCCCNC2=O)cc1-c1nn2c(C3CCCC3)nnc2c(=O)[nH]1 |
| InChI | InChI=1S/C23H29N7O5S/c1-2-35-18-11-10-15(36(33,34)29-17-9-5-6-12-24-22(17)31)13-16(18)19-25-23(32)21-27-26-20(30(21)28-19)14-7-3-4-8-14/h10-11,13-14,17,29H,2-9,12H2,1H3,(H,24,31)(H,25,28,32) |
| InChIKey | WFWKIDSKTWWFIH-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 160.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.60 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |