C19H12ClN3O3S2 — CID 135597812
3-chloro-N-[4-hydroxy-5-(7-methyl-2-oxoindol-3-yl)-2-sulfanylidene-1,3-thiazol-3-yl]benzamide (PubChem CID 135597812) has the molecular formula C19H12ClN3O3S2 and a molecular weight of 429.91 g/mol. Its IUPAC name is 3-chloro-N-[4-hydroxy-5-(7-methyl-2-oxoindol-3-yl)-2-sulfanylidene-1,3-thiazol-3-yl]benzamide.
| Compound Name | 3-chloro-N-[4-hydroxy-5-(7-methyl-2-oxoindol-3-yl)-2-sulfanylidene-1,3-thiazol-3-yl]benzamide |
|---|---|
| PubChem CID | 135597812 |
| Molecular Formula | C19H12ClN3O3S2 |
| Molecular Weight | 429.91 g/mol |
| Exact Mass | 429.00 |
| IUPAC Name | 3-chloro-N-[4-hydroxy-5-(7-methyl-2-oxoindol-3-yl)-2-sulfanylidene-1,3-thiazol-3-yl]benzamide |
| SMILES | Cc1cccc2c1=NC(=O)C=2c1sc(=S)n(NC(=O)c2cccc(Cl)c2)c1O |
| InChI | InChI=1S/C19H12ClN3O3S2/c1-9-4-2-7-12-13(17(25)21-14(9)12)15-18(26)23(19(27)28-15)22-16(24)10-5-3-6-11(20)8-10/h2-8,26H,1H3,(H,22,24) |
| InChIKey | FUTYSULQZLWAPO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 83.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.91 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|