C12H10FN3O3 — CID 135598715
N-[(4-fluorophenyl)methyl]-5-hydroxy-6-oxo-1H-pyrimidine-4-carboxamide (PubChem CID 135598715) has the molecular formula C12H10FN3O3 and a molecular weight of 263.23 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-5-hydroxy-6-oxo-1H-pyrimidine-4-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-5-hydroxy-6-oxo-1H-pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 135598715 |
| Molecular Formula | C12H10FN3O3 |
| Molecular Weight | 263.23 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-5-hydroxy-6-oxo-1H-pyrimidine-4-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1nc[nH]c(=O)c1O |
| InChI | InChI=1S/C12H10FN3O3/c13-8-3-1-7(2-4-8)5-14-11(18)9-10(17)12(19)16-6-15-9/h1-4,6,17H,5H2,(H,14,18)(H,15,16,19) |
| InChIKey | LFEJBNSZPNQXNF-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.23 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |