C18H16INO3 — CID 135598854
[(E)-(6-hydroxy-7-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino] 2-iodobenzoate (PubChem CID 135598854) has the molecular formula C18H16INO3 and a molecular weight of 421.23 g/mol. Its IUPAC name is [(E)-(6-hydroxy-7-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino] 2-iodobenzoate.
| Compound Name | [(E)-(6-hydroxy-7-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino] 2-iodobenzoate |
|---|---|
| PubChem CID | 135598854 |
| Molecular Formula | C18H16INO3 |
| Molecular Weight | 421.23 g/mol |
| Exact Mass | 421.02 |
| IUPAC Name | [(E)-(6-hydroxy-7-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino] 2-iodobenzoate |
| SMILES | Cc1cc2c(cc1O)CCC/C2=N\OC(=O)c1ccccc1I |
| InChI | InChI=1S/C18H16INO3/c1-11-9-14-12(10-17(11)21)5-4-8-16(14)20-23-18(22)13-6-2-3-7-15(13)19/h2-3,6-7,9-10,21H,4-5,8H2,1H3/b20-16+ |
| InChIKey | WBEKIGNSMZMIBT-CAPFRKAQSA-N |
| XLogP | 4.20 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.23 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|