C10H7Br2N3O2S — CID 135599001
2-[(E)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-4H-1,3,4-thiadiazin-5-one (PubChem CID 135599001) has the molecular formula C10H7Br2N3O2S and a molecular weight of 393.06 g/mol. Its IUPAC name is 2-[(E)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-4H-1,3,4-thiadiazin-5-one.
| Compound Name | 2-[(E)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-4H-1,3,4-thiadiazin-5-one |
|---|---|
| PubChem CID | 135599001 |
| Molecular Formula | C10H7Br2N3O2S |
| Molecular Weight | 393.06 g/mol |
| Exact Mass | 390.86 |
| IUPAC Name | 2-[(E)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-4H-1,3,4-thiadiazin-5-one |
| SMILES | O=C1CSC(/N=C/c2cc(Br)c(O)c(Br)c2)=NN1 |
| InChI | InChI=1S/C10H7Br2N3O2S/c11-6-1-5(2-7(12)9(6)17)3-13-10-15-14-8(16)4-18-10/h1-3,17H,4H2,(H,14,16)/b13-3+ |
| InChIKey | YOOWEUPTLPXQKJ-QLKAYGNNSA-N |
| XLogP | 2.47 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.06 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|