About 3-bromo-1-(2,3-dihydroxypropyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one
3-bromo-1-(2,3-dihydroxypropyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 135599159) has the molecular formula C8H9BrN4O3
and a molecular weight of 289.09 g/mol. Its IUPAC name is 3-bromo-1-(2,3-dihydroxypropyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-bromo-1-(2,3-dihydroxypropyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| PubChem CID | 135599159 |
| Molecular Formula | C8H9BrN4O3 |
| Molecular Weight | 289.09 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | 3-bromo-1-(2,3-dihydroxypropyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]cnc2c1c(Br)nn2CC(O)CO |
| InChI | InChI=1S/C8H9BrN4O3/c9-6-5-7(10-3-11-8(5)16)13(12-6)1-4(15)2-14/h3-4,14-15H,1-2H2,(H,10,11,16) |
| InChIKey | NJWULZTWSZJMSA-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.09 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-bromo-1-(2,3-dihydroxypropyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-1-(2,3-dihydroxypropyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one?
The IUPAC name of 3-bromo-1-(2,3-dihydroxypropyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one (CID 135599159) is 3-bromo-1-(2,3-dihydroxypropyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one.
What is the SMILES notation for 3-bromo-1-(2,3-dihydroxypropyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one?
The canonical SMILES for 3-bromo-1-(2,3-dihydroxypropyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one is O=c1[nH]cnc2c1c(Br)nn2CC(O)CO.
What is the InChIKey of 3-bromo-1-(2,3-dihydroxypropyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one?
The InChIKey is NJWULZTWSZJMSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BrN4O3/c9-6-5-7(10-3-11-8(5)16)13(12-6)1-4(15)2-14/h3-4,14-15H,1-2H2,(H,10,11,16).
What are the key properties of 3-bromo-1-(2,3-dihydroxypropyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one?
3-bromo-1-(2,3-dihydroxypropyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one has a molecular weight of 289.09 g/mol, XLogP of -0.76, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-1-(2,3-dihydroxypropyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one is sourced from PubChem (CID 135599159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).