C18H19ClN4O3 — CID 135599766
(2E)-N'-(3-chlorophenyl)-2-[(E)-(2,4-dimethoxyphenyl)methylidenehydrazinylidene]-N-hydroxypropanimidamide (PubChem CID 135599766) has the molecular formula C18H19ClN4O3 and a molecular weight of 374.83 g/mol. Its IUPAC name is (2E)-N'-(3-chlorophenyl)-2-[(E)-(2,4-dimethoxyphenyl)methylidenehydrazinylidene]-N-hydroxypropanimidamide.
| Compound Name | (2E)-N'-(3-chlorophenyl)-2-[(E)-(2,4-dimethoxyphenyl)methylidenehydrazinylidene]-N-hydroxypropanimidamide |
|---|---|
| PubChem CID | 135599766 |
| Molecular Formula | C18H19ClN4O3 |
| Molecular Weight | 374.83 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | (2E)-N'-(3-chlorophenyl)-2-[(E)-(2,4-dimethoxyphenyl)methylidenehydrazinylidene]-N-hydroxypropanimidamide |
| SMILES | COc1ccc(/C=N/N=C(C)/C(=N/c2cccc(Cl)c2)NO)c(OC)c1 |
| InChI | InChI=1S/C18H19ClN4O3/c1-12(18(23-24)21-15-6-4-5-14(19)9-15)22-20-11-13-7-8-16(25-2)10-17(13)26-3/h4-11,24H,1-3H3,(H,21,23)/b20-11+,22-12+ |
| InChIKey | BNKOKDWDROHGIS-HTAXKFFTSA-N |
| XLogP | 3.86 |
| TPSA | 87.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.83 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|