About 4-(6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-7-yl)phenol
4-(6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-7-yl)phenol (PubChem CID 135599849) has the molecular formula C12H10N4O
and a molecular weight of 226.24 g/mol. Its IUPAC name is 4-(6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-7-yl)phenol.
Molecular Properties
| Compound Name | 4-(6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-7-yl)phenol |
| PubChem CID | 135599849 |
| Molecular Formula | C12H10N4O |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 4-(6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-7-yl)phenol |
| SMILES | Cc1nn2cnnc2cc1-c1ccc(O)cc1 |
| InChI | InChI=1S/C12H10N4O/c1-8-11(9-2-4-10(17)5-3-9)6-12-14-13-7-16(12)15-8/h2-7,17H,1H3 |
| InChIKey | HFFIKIRZMTYLFI-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 63.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-7-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-7-yl)phenol?
The IUPAC name of 4-(6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-7-yl)phenol (CID 135599849) is 4-(6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-7-yl)phenol.
What is the SMILES notation for 4-(6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-7-yl)phenol?
The canonical SMILES for 4-(6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-7-yl)phenol is Cc1nn2cnnc2cc1-c1ccc(O)cc1.
What is the InChIKey of 4-(6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-7-yl)phenol?
The InChIKey is HFFIKIRZMTYLFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N4O/c1-8-11(9-2-4-10(17)5-3-9)6-12-14-13-7-16(12)15-8/h2-7,17H,1H3.
What are the key properties of 4-(6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-7-yl)phenol?
4-(6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-7-yl)phenol has a molecular weight of 226.24 g/mol, XLogP of 1.81, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-7-yl)phenol is sourced from PubChem (CID 135599849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).