About 3-amino-2-(2,5-difluorophenyl)-5H-pyrazolo[4,3-c]quinolin-4-one
3-amino-2-(2,5-difluorophenyl)-5H-pyrazolo[4,3-c]quinolin-4-one (PubChem CID 135599933) has the molecular formula C16H10F2N4O
and a molecular weight of 312.28 g/mol. Its IUPAC name is 3-amino-2-(2,5-difluorophenyl)-5H-pyrazolo[4,3-c]quinolin-4-one.
Molecular Properties
| Compound Name | 3-amino-2-(2,5-difluorophenyl)-5H-pyrazolo[4,3-c]quinolin-4-one |
| PubChem CID | 135599933 |
| Molecular Formula | C16H10F2N4O |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 3-amino-2-(2,5-difluorophenyl)-5H-pyrazolo[4,3-c]quinolin-4-one |
| SMILES | Nc1c2c(=O)[nH]c3ccccc3c2nn1-c1cc(F)ccc1F |
| InChI | InChI=1S/C16H10F2N4O/c17-8-5-6-10(18)12(7-8)22-15(19)13-14(21-22)9-3-1-2-4-11(9)20-16(13)23/h1-7H,19H2,(H,20,23) |
| InChIKey | OLXFXBTUKWWVDA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 76.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-2-(2,5-difluorophenyl)-5H-pyrazolo[4,3-c]quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-(2,5-difluorophenyl)-5H-pyrazolo[4,3-c]quinolin-4-one?
The IUPAC name of 3-amino-2-(2,5-difluorophenyl)-5H-pyrazolo[4,3-c]quinolin-4-one (CID 135599933) is 3-amino-2-(2,5-difluorophenyl)-5H-pyrazolo[4,3-c]quinolin-4-one.
What is the SMILES notation for 3-amino-2-(2,5-difluorophenyl)-5H-pyrazolo[4,3-c]quinolin-4-one?
The canonical SMILES for 3-amino-2-(2,5-difluorophenyl)-5H-pyrazolo[4,3-c]quinolin-4-one is Nc1c2c(=O)[nH]c3ccccc3c2nn1-c1cc(F)ccc1F.
What is the InChIKey of 3-amino-2-(2,5-difluorophenyl)-5H-pyrazolo[4,3-c]quinolin-4-one?
The InChIKey is OLXFXBTUKWWVDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10F2N4O/c17-8-5-6-10(18)12(7-8)22-15(19)13-14(21-22)9-3-1-2-4-11(9)20-16(13)23/h1-7H,19H2,(H,20,23).
What are the key properties of 3-amino-2-(2,5-difluorophenyl)-5H-pyrazolo[4,3-c]quinolin-4-one?
3-amino-2-(2,5-difluorophenyl)-5H-pyrazolo[4,3-c]quinolin-4-one has a molecular weight of 312.28 g/mol, XLogP of 2.73, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-(2,5-difluorophenyl)-5H-pyrazolo[4,3-c]quinolin-4-one is sourced from PubChem (CID 135599933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).