C10H10N3O+ — CID 135600871
10-amino-7-aza-2-azoniatricyclo[6.3.1.04,12]dodeca-1(11),2,4(12),7,9-pentaen-11-ol (PubChem CID 135600871) has the molecular formula C10H10N3O+ and a molecular weight of 188.21 g/mol. Its IUPAC name is 10-amino-7-aza-2-azoniatricyclo[6.3.1.04,12]dodeca-1(11),2,4(12),7,9-pentaen-11-ol.
| Compound Name | 10-amino-7-aza-2-azoniatricyclo[6.3.1.04,12]dodeca-1(11),2,4(12),7,9-pentaen-11-ol |
|---|---|
| PubChem CID | 135600871 |
| Molecular Formula | C10H10N3O+ |
| Molecular Weight | 188.21 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 10-amino-7-aza-2-azoniatricyclo[6.3.1.04,12]dodeca-1(11),2,4(12),7,9-pentaen-11-ol |
| SMILES | Nc1cc2c3c(c1O)[NH+]=CC=3CCN=2 |
| InChI | InChI=1S/C10H9N3O/c11-6-3-7-8-5(1-2-12-7)4-13-9(8)10(6)14/h3-4,14H,1-2,11H2/p+1 |
| InChIKey | UTRVSXOLOJTIAD-UHFFFAOYSA-O |
| XLogP | -2.06 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.21 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|