C5H5N5O — CID 135600909
2-amino-3H-imidazo[1,2-a][1,3,5]triazin-4-one (PubChem CID 135600909) has the molecular formula C5H5N5O and a molecular weight of 151.13 g/mol. Its IUPAC name is 2-amino-3H-imidazo[1,2-a][1,3,5]triazin-4-one.
| Compound Name | 2-amino-3H-imidazo[1,2-a][1,3,5]triazin-4-one |
|---|---|
| PubChem CID | 135600909 |
| Molecular Formula | C5H5N5O |
| Molecular Weight | 151.13 g/mol |
| Exact Mass | 151.05 |
| IUPAC Name | 2-amino-3H-imidazo[1,2-a][1,3,5]triazin-4-one |
| SMILES | Nc1nc2nccn2c(=O)[nH]1 |
| InChI | InChI=1S/C5H5N5O/c6-3-8-4-7-1-2-10(4)5(11)9-3/h1-2H,(H3,6,7,8,9,11) |
| InChIKey | KSTJOICDZAFYTD-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.13 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |