C17H18Cl2N4O4 — CID 135601508
5-[(5R)-5-(2,4-dichlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-6-hydroxy-1-(3-methoxypropyl)pyrimidine-2,4-dione (PubChem CID 135601508) has the molecular formula C17H18Cl2N4O4 and a molecular weight of 413.26 g/mol. Its IUPAC name is 5-[(5R)-5-(2,4-dichlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-6-hydroxy-1-(3-methoxypropyl)pyrimidine-2,4-dione.
| Compound Name | 5-[(5R)-5-(2,4-dichlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-6-hydroxy-1-(3-methoxypropyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135601508 |
| Molecular Formula | C17H18Cl2N4O4 |
| Molecular Weight | 413.26 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 5-[(5R)-5-(2,4-dichlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-6-hydroxy-1-(3-methoxypropyl)pyrimidine-2,4-dione |
| SMILES | COCCCn1c(O)c(C2=NN[C@@H](c3ccc(Cl)cc3Cl)C2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H18Cl2N4O4/c1-27-6-2-5-23-16(25)14(15(24)20-17(23)26)13-8-12(21-22-13)10-4-3-9(18)7-11(10)19/h3-4,7,12,21,25H,2,5-6,8H2,1H3,(H,20,24,26)/t12-/m1/s1 |
| InChIKey | PTZIGLKWIYVJCP-GFCCVEGCSA-N |
| XLogP | 2.02 |
| TPSA | 108.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|