C16H12FN3O3S — CID 135601971
N-[(3-fluorophenyl)methyl]-5-hydroxy-6-oxo-2-thiophen-2-yl-1H-pyrimidine-4-carboxamide (PubChem CID 135601971) has the molecular formula C16H12FN3O3S and a molecular weight of 345.36 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-5-hydroxy-6-oxo-2-thiophen-2-yl-1H-pyrimidine-4-carboxamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-5-hydroxy-6-oxo-2-thiophen-2-yl-1H-pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 135601971 |
| Molecular Formula | C16H12FN3O3S |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-5-hydroxy-6-oxo-2-thiophen-2-yl-1H-pyrimidine-4-carboxamide |
| SMILES | O=C(NCc1cccc(F)c1)c1nc(-c2cccs2)[nH]c(=O)c1O |
| InChI | InChI=1S/C16H12FN3O3S/c17-10-4-1-3-9(7-10)8-18-15(22)12-13(21)16(23)20-14(19-12)11-5-2-6-24-11/h1-7,21H,8H2,(H,18,22)(H,19,20,23) |
| InChIKey | JKZKDZIHUSQGMT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |