C12H16N2O2 — CID 135602130
(NE)-N-[[4-[(E)-hydroxyiminomethyl]-2,3,5,6-tetramethylphenyl]methylidene]hydroxylamine (PubChem CID 135602130) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is (NE)-N-[[4-[(E)-hydroxyiminomethyl]-2,3,5,6-tetramethylphenyl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[4-[(E)-hydroxyiminomethyl]-2,3,5,6-tetramethylphenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 135602130 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | (NE)-N-[[4-[(E)-hydroxyiminomethyl]-2,3,5,6-tetramethylphenyl]methylidene]hydroxylamine |
| SMILES | Cc1c(C)c(/C=N/O)c(C)c(C)c1/C=N/O |
| InChI | InChI=1S/C12H16N2O2/c1-7-8(2)12(6-14-16)10(4)9(3)11(7)5-13-15/h5-6,15-16H,1-4H3/b13-5+,14-6+ |
| InChIKey | SFEKTPODPIECNA-ACFHMISVSA-N |
| XLogP | 2.54 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|