C11H16F3N3O — CID 135603402
2-(dipropylamino)-4-(trifluoromethyl)-1H-pyrimidin-6-one (PubChem CID 135603402) has the molecular formula C11H16F3N3O and a molecular weight of 263.26 g/mol. Its IUPAC name is 2-(dipropylamino)-4-(trifluoromethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-(dipropylamino)-4-(trifluoromethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135603402 |
| Molecular Formula | C11H16F3N3O |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 2-(dipropylamino)-4-(trifluoromethyl)-1H-pyrimidin-6-one |
| SMILES | CCCN(CCC)c1nc(C(F)(F)F)cc(=O)[nH]1 |
| InChI | InChI=1S/C11H16F3N3O/c1-3-5-17(6-4-2)10-15-8(11(12,13)14)7-9(18)16-10/h7H,3-6H2,1-2H3,(H,15,16,18) |
| InChIKey | CXEVZXFIVLPPJS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |