C13H19N3S — CID 135603614
2-(3,5-dihydro-2H-1,5-benzothiazepin-4-ylideneamino)-N,N-dimethylethanamine (PubChem CID 135603614) has the molecular formula C13H19N3S and a molecular weight of 249.38 g/mol. Its IUPAC name is 2-(3,5-dihydro-2H-1,5-benzothiazepin-4-ylideneamino)-N,N-dimethylethanamine.
| Compound Name | 2-(3,5-dihydro-2H-1,5-benzothiazepin-4-ylideneamino)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 135603614 |
| Molecular Formula | C13H19N3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 2-(3,5-dihydro-2H-1,5-benzothiazepin-4-ylideneamino)-N,N-dimethylethanamine |
| SMILES | CN(C)CC/N=C1\CCSc2ccccc2N1 |
| InChI | InChI=1S/C13H19N3S/c1-16(2)9-8-14-13-7-10-17-12-6-4-3-5-11(12)15-13/h3-6H,7-10H2,1-2H3,(H,14,15) |
| InChIKey | YETBZWZAWYWIOU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|