About N-butyl-3,5-dihydro-2H-1,5-benzothiazepin-4-imine
N-butyl-3,5-dihydro-2H-1,5-benzothiazepin-4-imine (PubChem CID 135603615) has the molecular formula C13H18N2S
and a molecular weight of 234.37 g/mol. Its IUPAC name is N-butyl-3,5-dihydro-2H-1,5-benzothiazepin-4-imine.
Molecular Properties
| Compound Name | N-butyl-3,5-dihydro-2H-1,5-benzothiazepin-4-imine |
| PubChem CID | 135603615 |
| Molecular Formula | C13H18N2S |
| Molecular Weight | 234.37 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | N-butyl-3,5-dihydro-2H-1,5-benzothiazepin-4-imine |
| SMILES | CCCC/N=C1\CCSc2ccccc2N1 |
| InChI | InChI=1S/C13H18N2S/c1-2-3-9-14-13-8-10-16-12-7-5-4-6-11(12)15-13/h4-7H,2-3,8-10H2,1H3,(H,14,15) |
| InChIKey | POMYBQOXFCDNCE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-3,5-dihydro-2H-1,5-benzothiazepin-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-3,5-dihydro-2H-1,5-benzothiazepin-4-imine?
The IUPAC name of N-butyl-3,5-dihydro-2H-1,5-benzothiazepin-4-imine (CID 135603615) is N-butyl-3,5-dihydro-2H-1,5-benzothiazepin-4-imine.
What is the SMILES notation for N-butyl-3,5-dihydro-2H-1,5-benzothiazepin-4-imine?
The canonical SMILES for N-butyl-3,5-dihydro-2H-1,5-benzothiazepin-4-imine is CCCC/N=C1\CCSc2ccccc2N1.
What is the InChIKey of N-butyl-3,5-dihydro-2H-1,5-benzothiazepin-4-imine?
The InChIKey is POMYBQOXFCDNCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2S/c1-2-3-9-14-13-8-10-16-12-7-5-4-6-11(12)15-13/h4-7H,2-3,8-10H2,1H3,(H,14,15).
What are the key properties of N-butyl-3,5-dihydro-2H-1,5-benzothiazepin-4-imine?
N-butyl-3,5-dihydro-2H-1,5-benzothiazepin-4-imine has a molecular weight of 234.37 g/mol, XLogP of 3.79, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-3,5-dihydro-2H-1,5-benzothiazepin-4-imine is sourced from PubChem (CID 135603615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).