C15H10N4O3 — CID 135603924
(3Z)-3-[(Z)-(4-nitrophenyl)methylidenehydrazinylidene]-1H-indol-2-one (PubChem CID 135603924) has the molecular formula C15H10N4O3 and a molecular weight of 294.27 g/mol. Its IUPAC name is (3Z)-3-[(Z)-(4-nitrophenyl)methylidenehydrazinylidene]-1H-indol-2-one.
| Compound Name | (3Z)-3-[(Z)-(4-nitrophenyl)methylidenehydrazinylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 135603924 |
| Molecular Formula | C15H10N4O3 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | (3Z)-3-[(Z)-(4-nitrophenyl)methylidenehydrazinylidene]-1H-indol-2-one |
| SMILES | O=C1Nc2ccccc2/C1=N/N=C\c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H10N4O3/c20-15-14(12-3-1-2-4-13(12)17-15)18-16-9-10-5-7-11(8-6-10)19(21)22/h1-9H,(H,17,18,20)/b16-9- |
| InChIKey | NSOVHQFAWSUPMB-SXGWCWSVSA-N |
| XLogP | 2.37 |
| TPSA | 96.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|