About 5-(C,N-dimethylcarbonimidoyl)-4-hydroxy-2-methyl-2,3-dihydropyran-6-one
5-(C,N-dimethylcarbonimidoyl)-4-hydroxy-2-methyl-2,3-dihydropyran-6-one (PubChem CID 135604524) has the molecular formula C9H13NO3
and a molecular weight of 183.21 g/mol. Its IUPAC name is 5-(C,N-dimethylcarbonimidoyl)-4-hydroxy-2-methyl-2,3-dihydropyran-6-one.
Molecular Properties
| Compound Name | 5-(C,N-dimethylcarbonimidoyl)-4-hydroxy-2-methyl-2,3-dihydropyran-6-one |
| PubChem CID | 135604524 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 5-(C,N-dimethylcarbonimidoyl)-4-hydroxy-2-methyl-2,3-dihydropyran-6-one |
| SMILES | C/N=C(\C)C1=C(O)CC(C)OC1=O |
| InChI | InChI=1S/C9H13NO3/c1-5-4-7(11)8(6(2)10-3)9(12)13-5/h5,11H,4H2,1-3H3/b10-6+ |
| InChIKey | ZJKIRLMETFFGEQ-UXBLZVDNSA-N |
| XLogP | 1.22 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-(C,N-dimethylcarbonimidoyl)-4-hydroxy-2-methyl-2,3-dihydropyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(C,N-dimethylcarbonimidoyl)-4-hydroxy-2-methyl-2,3-dihydropyran-6-one?
The IUPAC name of 5-(C,N-dimethylcarbonimidoyl)-4-hydroxy-2-methyl-2,3-dihydropyran-6-one (CID 135604524) is 5-(C,N-dimethylcarbonimidoyl)-4-hydroxy-2-methyl-2,3-dihydropyran-6-one.
What is the SMILES notation for 5-(C,N-dimethylcarbonimidoyl)-4-hydroxy-2-methyl-2,3-dihydropyran-6-one?
The canonical SMILES for 5-(C,N-dimethylcarbonimidoyl)-4-hydroxy-2-methyl-2,3-dihydropyran-6-one is C/N=C(\C)C1=C(O)CC(C)OC1=O.
What is the InChIKey of 5-(C,N-dimethylcarbonimidoyl)-4-hydroxy-2-methyl-2,3-dihydropyran-6-one?
The InChIKey is ZJKIRLMETFFGEQ-UXBLZVDNSA-N. The full InChI is InChI=1S/C9H13NO3/c1-5-4-7(11)8(6(2)10-3)9(12)13-5/h5,11H,4H2,1-3H3/b10-6+.
What are the key properties of 5-(C,N-dimethylcarbonimidoyl)-4-hydroxy-2-methyl-2,3-dihydropyran-6-one?
5-(C,N-dimethylcarbonimidoyl)-4-hydroxy-2-methyl-2,3-dihydropyran-6-one has a molecular weight of 183.21 g/mol, XLogP of 1.22, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(C,N-dimethylcarbonimidoyl)-4-hydroxy-2-methyl-2,3-dihydropyran-6-one is sourced from PubChem (CID 135604524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).