C21H21F4N3O2 — CID 135605546
3-[[4-[ethyl(2-methoxyethyl)amino]-3-(trifluoromethyl)phenyl]iminomethyl]-5-fluoro-1H-indol-2-ol (PubChem CID 135605546) has the molecular formula C21H21F4N3O2 and a molecular weight of 423.41 g/mol. Its IUPAC name is 3-[[4-[ethyl(2-methoxyethyl)amino]-3-(trifluoromethyl)phenyl]iminomethyl]-5-fluoro-1H-indol-2-ol.
| Compound Name | 3-[[4-[ethyl(2-methoxyethyl)amino]-3-(trifluoromethyl)phenyl]iminomethyl]-5-fluoro-1H-indol-2-ol |
|---|---|
| PubChem CID | 135605546 |
| Molecular Formula | C21H21F4N3O2 |
| Molecular Weight | 423.41 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 3-[[4-[ethyl(2-methoxyethyl)amino]-3-(trifluoromethyl)phenyl]iminomethyl]-5-fluoro-1H-indol-2-ol |
| SMILES | CCN(CCOC)c1ccc(/N=C/c2c(O)[nH]c3ccc(F)cc23)cc1C(F)(F)F |
| InChI | InChI=1S/C21H21F4N3O2/c1-3-28(8-9-30-2)19-7-5-14(11-17(19)21(23,24)25)26-12-16-15-10-13(22)4-6-18(15)27-20(16)29/h4-7,10-12,27,29H,3,8-9H2,1-2H3/b26-12+ |
| InChIKey | RCTVZUPIYLHZLA-RPPGKUMJSA-N |
| XLogP | 5.25 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.41 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|