C24H22N4O4 — CID 135607011
N-[1-[4-[[2-[(E)-(2-hydroxyphenyl)methylideneamino]oxyacetyl]amino]phenyl]ethylideneamino]benzamide (PubChem CID 135607011) has the molecular formula C24H22N4O4 and a molecular weight of 430.46 g/mol. Its IUPAC name is N-[1-[4-[[2-[(E)-(2-hydroxyphenyl)methylideneamino]oxyacetyl]amino]phenyl]ethylideneamino]benzamide.
| Compound Name | N-[1-[4-[[2-[(E)-(2-hydroxyphenyl)methylideneamino]oxyacetyl]amino]phenyl]ethylideneamino]benzamide |
|---|---|
| PubChem CID | 135607011 |
| Molecular Formula | C24H22N4O4 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | N-[1-[4-[[2-[(E)-(2-hydroxyphenyl)methylideneamino]oxyacetyl]amino]phenyl]ethylideneamino]benzamide |
| SMILES | CC(=NNC(=O)c1ccccc1)c1ccc(NC(=O)CO/N=C/c2ccccc2O)cc1 |
| InChI | InChI=1S/C24H22N4O4/c1-17(27-28-24(31)19-7-3-2-4-8-19)18-11-13-21(14-12-18)26-23(30)16-32-25-15-20-9-5-6-10-22(20)29/h2-15,29H,16H2,1H3,(H,26,30)(H,28,31)/b25-15+,27-17? |
| InChIKey | YGYCGQAMLWVKPA-YAOTTWHDSA-N |
| XLogP | 3.54 |
| TPSA | 112.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|