C17H15ClFN5O3 — CID 135608980
(2E,4R)-3-(3-chloro-4-fluorophenyl)-2-(4,6-dimethylpyrimidin-2-yl)imino-6-oxo-1,3-diazinane-4-carboxylic acid (PubChem CID 135608980) has the molecular formula C17H15ClFN5O3 and a molecular weight of 391.79 g/mol. Its IUPAC name is (2E,4R)-3-(3-chloro-4-fluorophenyl)-2-(4,6-dimethylpyrimidin-2-yl)imino-6-oxo-1,3-diazinane-4-carboxylic acid.
| Compound Name | (2E,4R)-3-(3-chloro-4-fluorophenyl)-2-(4,6-dimethylpyrimidin-2-yl)imino-6-oxo-1,3-diazinane-4-carboxylic acid |
|---|---|
| PubChem CID | 135608980 |
| Molecular Formula | C17H15ClFN5O3 |
| Molecular Weight | 391.79 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | (2E,4R)-3-(3-chloro-4-fluorophenyl)-2-(4,6-dimethylpyrimidin-2-yl)imino-6-oxo-1,3-diazinane-4-carboxylic acid |
| SMILES | Cc1cc(C)nc(/N=C2\NC(=O)C[C@H](C(=O)O)N2c2ccc(F)c(Cl)c2)n1 |
| InChI | InChI=1S/C17H15ClFN5O3/c1-8-5-9(2)21-16(20-8)23-17-22-14(25)7-13(15(26)27)24(17)10-3-4-12(19)11(18)6-10/h3-6,13H,7H2,1-2H3,(H,26,27)(H,20,21,22,23,25)/t13-/m1/s1 |
| InChIKey | UVFYJPLHWMSETR-CYBMUJFWSA-N |
| XLogP | 2.35 |
| TPSA | 107.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.79 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|