C22H30N2O — CID 135609674
4-[6-(2-ethylhexyl)-5,6,7,8-tetrahydroquinazolin-2-yl]phenol (PubChem CID 135609674) has the molecular formula C22H30N2O and a molecular weight of 338.50 g/mol. Its IUPAC name is 4-[6-(2-ethylhexyl)-5,6,7,8-tetrahydroquinazolin-2-yl]phenol.
| Compound Name | 4-[6-(2-ethylhexyl)-5,6,7,8-tetrahydroquinazolin-2-yl]phenol |
|---|---|
| PubChem CID | 135609674 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | 4-[6-(2-ethylhexyl)-5,6,7,8-tetrahydroquinazolin-2-yl]phenol |
| SMILES | CCCCC(CC)CC1CCc2nc(-c3ccc(O)cc3)ncc2C1 |
| InChI | InChI=1S/C22H30N2O/c1-3-5-6-16(4-2)13-17-7-12-21-19(14-17)15-23-22(24-21)18-8-10-20(25)11-9-18/h8-11,15-17,25H,3-7,12-14H2,1-2H3 |
| InChIKey | MPWJPRURFAYRHT-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |