C19H14N4O2 — CID 135610077
4-[8-amino-2-(4-hydroxyphenyl)pyrido[3,4-b]pyrazin-3-yl]phenol (PubChem CID 135610077) has the molecular formula C19H14N4O2 and a molecular weight of 330.35 g/mol. Its IUPAC name is 4-[8-amino-2-(4-hydroxyphenyl)pyrido[3,4-b]pyrazin-3-yl]phenol.
| Compound Name | 4-[8-amino-2-(4-hydroxyphenyl)pyrido[3,4-b]pyrazin-3-yl]phenol |
|---|---|
| PubChem CID | 135610077 |
| Molecular Formula | C19H14N4O2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 4-[8-amino-2-(4-hydroxyphenyl)pyrido[3,4-b]pyrazin-3-yl]phenol |
| SMILES | Nc1cncc2nc(-c3ccc(O)cc3)c(-c3ccc(O)cc3)nc12 |
| InChI | InChI=1S/C19H14N4O2/c20-15-9-21-10-16-19(15)23-18(12-3-7-14(25)8-4-12)17(22-16)11-1-5-13(24)6-2-11/h1-10,24-25H,20H2 |
| InChIKey | PNJIVJBQCZJXFE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |