C26H25F3N4O7S — CID 135610112
3-[[2-[2-[2-[(5-carbamimidoyl-2-hydroxyphenyl)sulfonylamino]ethyl]-5-(3,4,5-trifluorophenyl)phenoxy]acetyl]amino]propanoic acid (PubChem CID 135610112) has the molecular formula C26H25F3N4O7S and a molecular weight of 594.57 g/mol. Its IUPAC name is 3-[[2-[2-[2-[(5-carbamimidoyl-2-hydroxyphenyl)sulfonylamino]ethyl]-5-(3,4,5-trifluorophenyl)phenoxy]acetyl]amino]propanoic acid.
| Compound Name | 3-[[2-[2-[2-[(5-carbamimidoyl-2-hydroxyphenyl)sulfonylamino]ethyl]-5-(3,4,5-trifluorophenyl)phenoxy]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 135610112 |
| Molecular Formula | C26H25F3N4O7S |
| Molecular Weight | 594.57 g/mol |
| Exact Mass | 594.14 |
| IUPAC Name | 3-[[2-[2-[2-[(5-carbamimidoyl-2-hydroxyphenyl)sulfonylamino]ethyl]-5-(3,4,5-trifluorophenyl)phenoxy]acetyl]amino]propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(O)c(S(=O)(=O)NCCc2ccc(-c3cc(F)c(F)c(F)c3)cc2OCC(=O)NCCC(=O)O)c1 |
| InChI | InChI=1S/C26H25F3N4O7S/c27-18-9-17(10-19(28)25(18)29)15-2-1-14(21(11-15)40-13-23(35)32-7-6-24(36)37)5-8-33-41(38,39)22-12-16(26(30)31)3-4-20(22)34/h1-4,9-12,33-34H,5-8,13H2,(H3,30,31)(H,32,35)(H,36,37) |
| InChIKey | FRDZNVGLSFASBE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 191.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.57 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|