C10H9F5N2O3 — CID 135610881
(Z)-1-(2,6-dimethoxypyrimidin-4-yl)-3,3,4,4,4-pentafluorobut-1-en-2-ol (PubChem CID 135610881) has the molecular formula C10H9F5N2O3 and a molecular weight of 300.18 g/mol. Its IUPAC name is (Z)-1-(2,6-dimethoxypyrimidin-4-yl)-3,3,4,4,4-pentafluorobut-1-en-2-ol.
| Compound Name | (Z)-1-(2,6-dimethoxypyrimidin-4-yl)-3,3,4,4,4-pentafluorobut-1-en-2-ol |
|---|---|
| PubChem CID | 135610881 |
| Molecular Formula | C10H9F5N2O3 |
| Molecular Weight | 300.18 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | (Z)-1-(2,6-dimethoxypyrimidin-4-yl)-3,3,4,4,4-pentafluorobut-1-en-2-ol |
| SMILES | COc1cc(/C=C(\O)C(F)(F)C(F)(F)F)nc(OC)n1 |
| InChI | InChI=1S/C10H9F5N2O3/c1-19-7-4-5(16-8(17-7)20-2)3-6(18)9(11,12)10(13,14)15/h3-4,18H,1-2H3/b6-3- |
| InChIKey | VWONJHMBROXKIW-UTCJRWHESA-N |
| XLogP | 2.59 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.18 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|