C19H17N5OS — CID 135611095
(4Z)-4-benzylidene-2-[(4-phenyl-2-sulfanylideneimidazolidin-1-yl)amino]-1H-imidazol-5-one (PubChem CID 135611095) has the molecular formula C19H17N5OS and a molecular weight of 363.45 g/mol. Its IUPAC name is (4Z)-4-benzylidene-2-[(4-phenyl-2-sulfanylideneimidazolidin-1-yl)amino]-1H-imidazol-5-one.
| Compound Name | (4Z)-4-benzylidene-2-[(4-phenyl-2-sulfanylideneimidazolidin-1-yl)amino]-1H-imidazol-5-one |
|---|---|
| PubChem CID | 135611095 |
| Molecular Formula | C19H17N5OS |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | (4Z)-4-benzylidene-2-[(4-phenyl-2-sulfanylideneimidazolidin-1-yl)amino]-1H-imidazol-5-one |
| SMILES | O=C1NC(NN2CC(c3ccccc3)NC2=S)=N/C1=C\c1ccccc1 |
| InChI | InChI=1S/C19H17N5OS/c25-17-15(11-13-7-3-1-4-8-13)20-18(22-17)23-24-12-16(21-19(24)26)14-9-5-2-6-10-14/h1-11,16H,12H2,(H,21,26)(H2,20,22,23,25)/b15-11- |
| InChIKey | MNIRTGSEHYNJBI-PTNGSMBKSA-N |
| XLogP | 1.95 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|