C20H17N5O3S2 — CID 135611102
2-hydroxy-5-[3-[(4-methylsulfanylphenyl)methyl]-4-oxo-8H-[1,2,4]triazino[3,4-b][1,3,4]thiadiazin-7-yl]benzamide (PubChem CID 135611102) has the molecular formula C20H17N5O3S2 and a molecular weight of 439.52 g/mol. Its IUPAC name is 2-hydroxy-5-[3-[(4-methylsulfanylphenyl)methyl]-4-oxo-8H-[1,2,4]triazino[3,4-b][1,3,4]thiadiazin-7-yl]benzamide.
| Compound Name | 2-hydroxy-5-[3-[(4-methylsulfanylphenyl)methyl]-4-oxo-8H-[1,2,4]triazino[3,4-b][1,3,4]thiadiazin-7-yl]benzamide |
|---|---|
| PubChem CID | 135611102 |
| Molecular Formula | C20H17N5O3S2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | 2-hydroxy-5-[3-[(4-methylsulfanylphenyl)methyl]-4-oxo-8H-[1,2,4]triazino[3,4-b][1,3,4]thiadiazin-7-yl]benzamide |
| SMILES | CSc1ccc(Cc2nnc3n(c2=O)N=C(c2ccc(O)c(C(N)=O)c2)CS3)cc1 |
| InChI | InChI=1S/C20H17N5O3S2/c1-29-13-5-2-11(3-6-13)8-15-19(28)25-20(23-22-15)30-10-16(24-25)12-4-7-17(26)14(9-12)18(21)27/h2-7,9,26H,8,10H2,1H3,(H2,21,27) |
| InChIKey | UZNARZNWELDBQB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'} |
|---|