C15H17F3N2OS — CID 135611142
5-methyl-5-propan-2-yl-2-[(1R)-2,2,2-trifluoro-1-phenylethyl]imino-1,3-thiazolidin-4-one (PubChem CID 135611142) has the molecular formula C15H17F3N2OS and a molecular weight of 330.38 g/mol. Its IUPAC name is 5-methyl-5-propan-2-yl-2-[(1R)-2,2,2-trifluoro-1-phenylethyl]imino-1,3-thiazolidin-4-one.
| Compound Name | 5-methyl-5-propan-2-yl-2-[(1R)-2,2,2-trifluoro-1-phenylethyl]imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135611142 |
| Molecular Formula | C15H17F3N2OS |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 5-methyl-5-propan-2-yl-2-[(1R)-2,2,2-trifluoro-1-phenylethyl]imino-1,3-thiazolidin-4-one |
| SMILES | CC(C)C1(C)S/C(=N\[C@H](c2ccccc2)C(F)(F)F)NC1=O |
| InChI | InChI=1S/C15H17F3N2OS/c1-9(2)14(3)12(21)20-13(22-14)19-11(15(16,17)18)10-7-5-4-6-8-10/h4-9,11H,1-3H3,(H,19,20,21)/t11-,14?/m1/s1 |
| InChIKey | IPSAPXHUJHULQX-YNODCEANSA-N |
| XLogP | 3.92 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|