C19H19ClN4O3S — CID 135611163
1-[3-[[5-(5-chloro-2-hydroxyphenyl)-2-oxo-6H-1,3,4-thiadiazin-3-yl]methyl]phenyl]-3-ethylurea (PubChem CID 135611163) has the molecular formula C19H19ClN4O3S and a molecular weight of 418.91 g/mol. Its IUPAC name is 1-[3-[[5-(5-chloro-2-hydroxyphenyl)-2-oxo-6H-1,3,4-thiadiazin-3-yl]methyl]phenyl]-3-ethylurea.
| Compound Name | 1-[3-[[5-(5-chloro-2-hydroxyphenyl)-2-oxo-6H-1,3,4-thiadiazin-3-yl]methyl]phenyl]-3-ethylurea |
|---|---|
| PubChem CID | 135611163 |
| Molecular Formula | C19H19ClN4O3S |
| Molecular Weight | 418.91 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 1-[3-[[5-(5-chloro-2-hydroxyphenyl)-2-oxo-6H-1,3,4-thiadiazin-3-yl]methyl]phenyl]-3-ethylurea |
| SMILES | CCNC(=O)Nc1cccc(CN2N=C(c3cc(Cl)ccc3O)CSC2=O)c1 |
| InChI | InChI=1S/C19H19ClN4O3S/c1-2-21-18(26)22-14-5-3-4-12(8-14)10-24-19(27)28-11-16(23-24)15-9-13(20)6-7-17(15)25/h3-9,25H,2,10-11H2,1H3,(H2,21,22,26) |
| InChIKey | ZVNMZLZWOFTBBD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.91 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|