C19H18N6O — CID 135611244
(4R)-2-benzylimino-8-methyl-4-pyridin-3-yl-3,4-dihydro-1H-pyrimido[1,2-a][1,3,5]triazin-6-one (PubChem CID 135611244) has the molecular formula C19H18N6O and a molecular weight of 346.39 g/mol. Its IUPAC name is (4R)-2-benzylimino-8-methyl-4-pyridin-3-yl-3,4-dihydro-1H-pyrimido[1,2-a][1,3,5]triazin-6-one.
| Compound Name | (4R)-2-benzylimino-8-methyl-4-pyridin-3-yl-3,4-dihydro-1H-pyrimido[1,2-a][1,3,5]triazin-6-one |
|---|---|
| PubChem CID | 135611244 |
| Molecular Formula | C19H18N6O |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | (4R)-2-benzylimino-8-methyl-4-pyridin-3-yl-3,4-dihydro-1H-pyrimido[1,2-a][1,3,5]triazin-6-one |
| SMILES | Cc1cc(=O)n2c(n1)N/C(=N\Cc1ccccc1)N[C@H]2c1cccnc1 |
| InChI | InChI=1S/C19H18N6O/c1-13-10-16(26)25-17(15-8-5-9-20-12-15)23-18(24-19(25)22-13)21-11-14-6-3-2-4-7-14/h2-10,12,17H,11H2,1H3,(H2,21,22,23,24)/t17-/m1/s1 |
| InChIKey | JTSXGBXGUJXJQG-QGZVFWFLSA-N |
| XLogP | 2.06 |
| TPSA | 84.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|