C28H42N4O6S — CID 135611687
2-[2-ethoxy-5-(6-ethoxy-1-hydroxyhexan-3-yl)sulfonylphenyl]-7-hexyl-5-methyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one (PubChem CID 135611687) has the molecular formula C28H42N4O6S and a molecular weight of 562.73 g/mol. Its IUPAC name is 2-[2-ethoxy-5-(6-ethoxy-1-hydroxyhexan-3-yl)sulfonylphenyl]-7-hexyl-5-methyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one.
| Compound Name | 2-[2-ethoxy-5-(6-ethoxy-1-hydroxyhexan-3-yl)sulfonylphenyl]-7-hexyl-5-methyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 135611687 |
| Molecular Formula | C28H42N4O6S |
| Molecular Weight | 562.73 g/mol |
| Exact Mass | 562.28 |
| IUPAC Name | 2-[2-ethoxy-5-(6-ethoxy-1-hydroxyhexan-3-yl)sulfonylphenyl]-7-hexyl-5-methyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one |
| SMILES | CCCCCCc1nc(C)c2c(=O)[nH]c(-c3cc(S(=O)(=O)C(CCO)CCCOCC)ccc3OCC)nn12 |
| InChI | InChI=1S/C28H42N4O6S/c1-5-8-9-10-13-25-29-20(4)26-28(34)30-27(31-32(25)26)23-19-22(14-15-24(23)38-7-3)39(35,36)21(16-17-33)12-11-18-37-6-2/h14-15,19,21,33H,5-13,16-18H2,1-4H3,(H,30,31,34) |
| InChIKey | OGDOYVASBKVQKG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 135.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.73 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|