C30H22N4O4 — CID 135611787
N-[(E)-(2-hydroxyphenyl)methylideneamino]-2-[4-(2-phenyl-1,8-naphthyridine-3-carbonyl)phenoxy]acetamide (PubChem CID 135611787) has the molecular formula C30H22N4O4 and a molecular weight of 502.53 g/mol. Its IUPAC name is N-[(E)-(2-hydroxyphenyl)methylideneamino]-2-[4-(2-phenyl-1,8-naphthyridine-3-carbonyl)phenoxy]acetamide.
| Compound Name | N-[(E)-(2-hydroxyphenyl)methylideneamino]-2-[4-(2-phenyl-1,8-naphthyridine-3-carbonyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 135611787 |
| Molecular Formula | C30H22N4O4 |
| Molecular Weight | 502.53 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | N-[(E)-(2-hydroxyphenyl)methylideneamino]-2-[4-(2-phenyl-1,8-naphthyridine-3-carbonyl)phenoxy]acetamide |
| SMILES | O=C(COc1ccc(C(=O)c2cc3cccnc3nc2-c2ccccc2)cc1)N/N=C/c1ccccc1O |
| InChI | InChI=1S/C30H22N4O4/c35-26-11-5-4-9-23(26)18-32-34-27(36)19-38-24-14-12-21(13-15-24)29(37)25-17-22-10-6-16-31-30(22)33-28(25)20-7-2-1-3-8-20/h1-18,35H,19H2,(H,34,36)/b32-18+ |
| InChIKey | QCAMQRIEFFOIHD-KCSSXMTESA-N |
| XLogP | 4.76 |
| TPSA | 113.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.53 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|